C15H23N5O2 — CID 135800219
N-(1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)-N',N'-dipropylethane-1,2-diamine (PubChem CID 135800219) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-(1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)-N',N'-dipropylethane-1,2-diamine.
| Compound Name | N-(1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)-N',N'-dipropylethane-1,2-diamine |
|---|---|
| PubChem CID | 135800219 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N-(1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)-N',N'-dipropylethane-1,2-diamine |
| SMILES | CCCN(CCC)CCNc1n[n+]([O-])c2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C15H23N5O2/c1-3-10-18(11-4-2)12-9-16-15-17-20(22)14-8-6-5-7-13(14)19(15)21/h5-8H,3-4,9-12H2,1-2H3,(H,16,17) |
| InChIKey | RMYPSZJDNSYYAU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|