C14H21N5O2 — CID 135800221
N',N'-diethyl-N-(6-methyl-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)ethane-1,2-diamine (PubChem CID 135800221) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is N',N'-diethyl-N-(6-methyl-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-(6-methyl-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 135800221 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N',N'-diethyl-N-(6-methyl-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1n[n+]([O-])c2ccc(C)cc2[n+]1[O-] |
| InChI | InChI=1S/C14H21N5O2/c1-4-17(5-2)9-8-15-14-16-19(21)12-7-6-11(3)10-13(12)18(14)20/h6-7,10H,4-5,8-9H2,1-3H3,(H,15,16) |
| InChIKey | XLBCPKVBBXYINT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|