C13H12ClN3O5S — CID 135800995
3-[(E)-[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]-N,2-dihydroxybenzeneamine oxide (PubChem CID 135800995) has the molecular formula C13H12ClN3O5S and a molecular weight of 357.78 g/mol. Its IUPAC name is 3-[(E)-[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]-N,2-dihydroxybenzeneamine oxide.
| Compound Name | 3-[(E)-[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]-N,2-dihydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 135800995 |
| Molecular Formula | C13H12ClN3O5S |
| Molecular Weight | 357.78 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 3-[(E)-[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]-N,2-dihydroxybenzeneamine oxide |
| SMILES | O=S(=O)(N/N=C/c1cccc([NH+]([O-])O)c1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H12ClN3O5S/c14-10-4-6-11(7-5-10)23(21,22)16-15-8-9-2-1-3-12(13(9)18)17(19)20/h1-8,16-19H/b15-8+ |
| InChIKey | GFBCODMYUQAZOH-OVCLIPMQSA-N |
| XLogP | 0.76 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.78 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|