C18H15N3O2S — CID 135801100
4-methoxy-N-[(Z)-(2-sulfanylidene-1H-quinolin-3-yl)methylideneamino]benzamide (PubChem CID 135801100) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is 4-methoxy-N-[(Z)-(2-sulfanylidene-1H-quinolin-3-yl)methylideneamino]benzamide.
| Compound Name | 4-methoxy-N-[(Z)-(2-sulfanylidene-1H-quinolin-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135801100 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 4-methoxy-N-[(Z)-(2-sulfanylidene-1H-quinolin-3-yl)methylideneamino]benzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2cc3ccccc3[nH]c2=S)cc1 |
| InChI | InChI=1S/C18H15N3O2S/c1-23-15-8-6-12(7-9-15)17(22)21-19-11-14-10-13-4-2-3-5-16(13)20-18(14)24/h2-11H,1H3,(H,20,24)(H,21,22)/b19-11- |
| InChIKey | OTCHKWIOBAZAOG-ODLFYWEKSA-N |
| XLogP | 3.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|