C18H20ClN5O4 — CID 135801322
14-[2-(dimethylamino)ethyl]-N,4-dihydroxy-15-oxo-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaen-10-amine oxide;hydrochloride (PubChem CID 135801322) has the molecular formula C18H20ClN5O4 and a molecular weight of 405.84 g/mol. Its IUPAC name is 14-[2-(dimethylamino)ethyl]-N,4-dihydroxy-15-oxo-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaen-10-amine oxide;hydrochloride.
| Compound Name | 14-[2-(dimethylamino)ethyl]-N,4-dihydroxy-15-oxo-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaen-10-amine oxide;hydrochloride |
|---|---|
| PubChem CID | 135801322 |
| Molecular Formula | C18H20ClN5O4 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 14-[2-(dimethylamino)ethyl]-N,4-dihydroxy-15-oxo-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaen-10-amine oxide;hydrochloride |
| SMILES | CN(C)CCn1c(=O)nc2c3c(c([NH+]([O-])O)ccc31)Nc1ccc(O)cc1-2.Cl |
| InChI | InChI=1S/C18H19N5O4.ClH/c1-21(2)7-8-22-13-5-6-14(23(26)27)17-15(13)16(20-18(22)25)11-9-10(24)3-4-12(11)19-17;/h3-6,9,19,23-24,26H,7-8H2,1-2H3;1H |
| InChIKey | QCNFIGQYWBYOJD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|