C17H25N3O3 — CID 135801501
3-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyliminomethyl)-N,4-dihydroxybenzeneamine oxide (PubChem CID 135801501) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 3-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyliminomethyl)-N,4-dihydroxybenzeneamine oxide.
| Compound Name | 3-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyliminomethyl)-N,4-dihydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 135801501 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 3-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyliminomethyl)-N,4-dihydroxybenzeneamine oxide |
| SMILES | [O-][NH+](O)c1ccc(O)c(/C=N/CC2CCCN3CCCCC23)c1 |
| InChI | InChI=1S/C17H25N3O3/c21-17-7-6-15(20(22)23)10-14(17)12-18-11-13-4-3-9-19-8-2-1-5-16(13)19/h6-7,10,12-13,16,20-22H,1-5,8-9,11H2/b18-12+ |
| InChIKey | XPNGNWFUTLLCJI-LDADJPATSA-N |
| XLogP | 1.48 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|