C13H9Cl3N2O2 — CID 135801844
4-[(E)-C-(2,4,6-trichlorophenyl)carbonohydrazonoyl]benzene-1,3-diol (PubChem CID 135801844) has the molecular formula C13H9Cl3N2O2 and a molecular weight of 331.59 g/mol. Its IUPAC name is 4-[(E)-C-(2,4,6-trichlorophenyl)carbonohydrazonoyl]benzene-1,3-diol.
| Compound Name | 4-[(E)-C-(2,4,6-trichlorophenyl)carbonohydrazonoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135801844 |
| Molecular Formula | C13H9Cl3N2O2 |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 4-[(E)-C-(2,4,6-trichlorophenyl)carbonohydrazonoyl]benzene-1,3-diol |
| SMILES | N/N=C(\c1ccc(O)cc1O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H9Cl3N2O2/c14-6-3-9(15)12(10(16)4-6)13(18-17)8-2-1-7(19)5-11(8)20/h1-5,19-20H,17H2/b18-13+ |
| InChIKey | JGPZGWBHAMQYHX-QGOAFFKASA-N |
| XLogP | 3.77 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|