C17H15N3O2 — CID 135801880
4-[(E)-C-(4-methylquinolin-2-yl)carbonohydrazonoyl]benzene-1,2-diol (PubChem CID 135801880) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 4-[(E)-C-(4-methylquinolin-2-yl)carbonohydrazonoyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-C-(4-methylquinolin-2-yl)carbonohydrazonoyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135801880 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 4-[(E)-C-(4-methylquinolin-2-yl)carbonohydrazonoyl]benzene-1,2-diol |
| SMILES | Cc1cc(/C(=N/N)c2ccc(O)c(O)c2)nc2ccccc12 |
| InChI | InChI=1S/C17H15N3O2/c1-10-8-14(19-13-5-3-2-4-12(10)13)17(20-18)11-6-7-15(21)16(22)9-11/h2-9,21-22H,18H2,1H3/b20-17+ |
| InChIKey | XOLCKAXSVBTVJT-LVZFUZTISA-N |
| XLogP | 2.67 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|