C29H26N8O4 — CID 135802855
3-[[2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]-6-oxo-5,7-dihydro-1H-pteridin-4-yl]oxy]-4-phenoxybenzenecarboximidamide (PubChem CID 135802855) has the molecular formula C29H26N8O4 and a molecular weight of 550.58 g/mol. Its IUPAC name is 3-[[2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]-6-oxo-5,7-dihydro-1H-pteridin-4-yl]oxy]-4-phenoxybenzenecarboximidamide.
| Compound Name | 3-[[2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]-6-oxo-5,7-dihydro-1H-pteridin-4-yl]oxy]-4-phenoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 135802855 |
| Molecular Formula | C29H26N8O4 |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 3-[[2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]-6-oxo-5,7-dihydro-1H-pteridin-4-yl]oxy]-4-phenoxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2ccccc2)c(OC2=C3NC(=O)CN=C3NC(Oc3cccc(C4=NCCN4C)c3)=N2)c1 |
| InChI | InChI=1S/C29H26N8O4/c1-37-13-12-32-27(37)18-6-5-9-20(14-18)40-29-35-26-24(34-23(38)16-33-26)28(36-29)41-22-15-17(25(30)31)10-11-21(22)39-19-7-3-2-4-8-19/h2-11,14-15H,12-13,16H2,1H3,(H3,30,31)(H,34,38)(H,33,35,36) |
| InChIKey | XCFCZFQWFLKVLK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 159.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|