C10H11N6O2+ — CID 135804417
(E)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium (PubChem CID 135804417) has the molecular formula C10H11N6O2+ and a molecular weight of 247.24 g/mol. Its IUPAC name is (E)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium.
| Compound Name | (E)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium |
|---|---|
| PubChem CID | 135804417 |
| Molecular Formula | C10H11N6O2+ |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | (E)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium |
| SMILES | NC(=N/[NH+]=C/c1ccccc1O)c1nonc1N |
| InChI | InChI=1S/C10H10N6O2/c11-9(8-10(12)16-18-15-8)14-13-5-6-3-1-2-4-7(6)17/h1-5,17H,(H2,11,14)(H2,12,16)/p+1/b13-5+ |
| InChIKey | AUZNLHHMEIQCHP-WLRTZDKTSA-O |
| XLogP | -1.82 |
| TPSA | 137.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|