C32H31BrCl2N4O4S — CID 135806284
benzyl 7-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135806284) has the molecular formula C32H31BrCl2N4O4S and a molecular weight of 718.50 g/mol. Its IUPAC name is benzyl 7-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | benzyl 7-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135806284 |
| Molecular Formula | C32H31BrCl2N4O4S |
| Molecular Weight | 718.50 g/mol |
| Exact Mass | 716.06 |
| IUPAC Name | benzyl 7-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCSc1nc2n(n1)C(c1cc(Br)c(OCc3ccc(Cl)cc3Cl)c(OCC)c1)C(C(=O)OCc1ccccc1)=C(C)N2 |
| InChI | InChI=1S/C32H31BrCl2N4O4S/c1-4-13-44-32-37-31-36-19(3)27(30(40)43-17-20-9-7-6-8-10-20)28(39(31)38-32)22-14-24(33)29(26(15-22)41-5-2)42-18-21-11-12-23(34)16-25(21)35/h6-12,14-16,28H,4-5,13,17-18H2,1-3H3,(H,36,37,38) |
| InChIKey | KOLLWVIOAUNGFX-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.50 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |