C33H37N5O3S — CID 135806470
N-(2,4-dimethylphenyl)-7-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135806470) has the molecular formula C33H37N5O3S and a molecular weight of 583.76 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-7-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-7-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135806470 |
| Molecular Formula | C33H37N5O3S |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | N-(2,4-dimethylphenyl)-7-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCSc1nc2n(n1)C(c1ccc(OCc3cccc(C)c3)c(OC)c1)C(C(=O)Nc1ccc(C)cc1C)=C(C)N2 |
| InChI | InChI=1S/C33H37N5O3S/c1-7-15-42-33-36-32-34-23(5)29(31(39)35-26-13-11-21(3)16-22(26)4)30(38(32)37-33)25-12-14-27(28(18-25)40-6)41-19-24-10-8-9-20(2)17-24/h8-14,16-18,30H,7,15,19H2,1-6H3,(H,35,39)(H,34,36,37) |
| InChIKey | NVKKCSGYDRFESE-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |