C21H26N3O4+ — CID 135808539
(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl-ethyl-(2-phenoxyethyl)azanium (PubChem CID 135808539) has the molecular formula C21H26N3O4+ and a molecular weight of 384.46 g/mol. Its IUPAC name is (6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl-ethyl-(2-phenoxyethyl)azanium.
| Compound Name | (6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl-ethyl-(2-phenoxyethyl)azanium |
|---|---|
| PubChem CID | 135808539 |
| Molecular Formula | C21H26N3O4+ |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl-ethyl-(2-phenoxyethyl)azanium |
| SMILES | CC[NH+](CCOc1ccccc1)Cc1nc2cc(OC)c(OC)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C21H25N3O4/c1-4-24(10-11-28-15-8-6-5-7-9-15)14-20-22-17-13-19(27-3)18(26-2)12-16(17)21(25)23-20/h5-9,12-13H,4,10-11,14H2,1-3H3,(H,22,23,25)/p+1 |
| InChIKey | JIULHEGIXTUIDQ-UHFFFAOYSA-O |
| XLogP | 1.42 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |