About 2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one
2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one (PubChem CID 135809496) has the molecular formula C18H16Cl2FN3O
and a molecular weight of 380.25 g/mol. Its IUPAC name is 2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one |
| PubChem CID | 135809496 |
| Molecular Formula | C18H16Cl2FN3O |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one |
| SMILES | C[C@H](N[C@@H](C)c1cc(F)c(Cl)cc1Cl)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H16Cl2FN3O/c1-9(12-7-15(21)14(20)8-13(12)19)22-10(2)17-23-16-6-4-3-5-11(16)18(25)24-17/h3-10,22H,1-2H3,(H,23,24,25)/t9-,10-/m0/s1 |
| InChIKey | GUAWKGBTPGTJEI-UWVGGRQHSA-N |
| XLogP | 4.78 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one?
The IUPAC name of 2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one (CID 135809496) is 2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one.
What is the SMILES notation for 2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one?
The canonical SMILES for 2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one is C[C@H](N[C@@H](C)c1cc(F)c(Cl)cc1Cl)c1nc2ccccc2c(=O)[nH]1.
What is the InChIKey of 2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one?
The InChIKey is GUAWKGBTPGTJEI-UWVGGRQHSA-N. The full InChI is InChI=1S/C18H16Cl2FN3O/c1-9(12-7-15(21)14(20)8-13(12)19)22-10(2)17-23-16-6-4-3-5-11(16)18(25)24-17/h3-10,22H,1-2H3,(H,23,24,25)/t9-,10-/m0/s1.
What are the key properties of 2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one?
2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one has a molecular weight of 380.25 g/mol, XLogP of 4.78, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-1-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]ethyl]-3H-quinazolin-4-one is sourced from PubChem (CID 135809496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).