C19H19FN2O2S — CID 135809907
5-(3,4-dimethylphenyl)-N-[(2-fluorophenyl)methyl]-4-methyl-1,1-dioxo-1,2-thiazol-3-imine (PubChem CID 135809907) has the molecular formula C19H19FN2O2S and a molecular weight of 358.44 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-[(2-fluorophenyl)methyl]-4-methyl-1,1-dioxo-1,2-thiazol-3-imine.
| Compound Name | 5-(3,4-dimethylphenyl)-N-[(2-fluorophenyl)methyl]-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 135809907 |
| Molecular Formula | C19H19FN2O2S |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-[(2-fluorophenyl)methyl]-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
| SMILES | CC1=C(c2ccc(C)c(C)c2)S(=O)(=O)N/C1=N\Cc1ccccc1F |
| InChI | InChI=1S/C19H19FN2O2S/c1-12-8-9-15(10-13(12)2)18-14(3)19(22-25(18,23)24)21-11-16-6-4-5-7-17(16)20/h4-10H,11H2,1-3H3,(H,21,22) |
| InChIKey | AAUCHJJEZOETNS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|