C9H7N3S — CID 135810293
5-methyl-2,6,11-triazatricyclo[5.3.1.04,11]undeca-1(10),4,6,8-tetraene-3-thione (PubChem CID 135810293) has the molecular formula C9H7N3S and a molecular weight of 189.24 g/mol. Its IUPAC name is 5-methyl-2,6,11-triazatricyclo[5.3.1.04,11]undeca-1(10),4,6,8-tetraene-3-thione.
| Compound Name | 5-methyl-2,6,11-triazatricyclo[5.3.1.04,11]undeca-1(10),4,6,8-tetraene-3-thione |
|---|---|
| PubChem CID | 135810293 |
| Molecular Formula | C9H7N3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 5-methyl-2,6,11-triazatricyclo[5.3.1.04,11]undeca-1(10),4,6,8-tetraene-3-thione |
| SMILES | Cc1nc2cccc3[nH]c(=S)c1n23 |
| InChI | InChI=1S/C9H7N3S/c1-5-8-9(13)11-7-4-2-3-6(10-5)12(7)8/h2-4H,1H3,(H,11,13) |
| InChIKey | NJWWYFPSNFGQOQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|