C18H11F5N2O — CID 135811561
2-[(E)-C-methyl-N-(2,3,4,5,6-pentafluoroanilino)carbonimidoyl]naphthalen-1-ol (PubChem CID 135811561) has the molecular formula C18H11F5N2O and a molecular weight of 366.29 g/mol. Its IUPAC name is 2-[(E)-C-methyl-N-(2,3,4,5,6-pentafluoroanilino)carbonimidoyl]naphthalen-1-ol.
| Compound Name | 2-[(E)-C-methyl-N-(2,3,4,5,6-pentafluoroanilino)carbonimidoyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 135811561 |
| Molecular Formula | C18H11F5N2O |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-[(E)-C-methyl-N-(2,3,4,5,6-pentafluoroanilino)carbonimidoyl]naphthalen-1-ol |
| SMILES | C/C(=N\Nc1c(F)c(F)c(F)c(F)c1F)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C18H11F5N2O/c1-8(10-7-6-9-4-2-3-5-11(9)18(10)26)24-25-17-15(22)13(20)12(19)14(21)16(17)23/h2-7,25-26H,1H3/b24-8+ |
| InChIKey | OTNXVEUCMKPZDU-KTZMUZOWSA-N |
| XLogP | 5.08 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|