C20H22BrN3O5S — CID 135813453
tert-butyl 2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (PubChem CID 135813453) has the molecular formula C20H22BrN3O5S and a molecular weight of 496.38 g/mol. Its IUPAC name is tert-butyl 2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | tert-butyl 2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 135813453 |
| Molecular Formula | C20H22BrN3O5S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | tert-butyl 2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CN1CCc2c(sc(N=Cc3cc(Br)cc([N+](=O)[O-])c3O)c2C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H22BrN3O5S/c1-20(2,3)29-19(26)16-13-5-6-23(4)10-15(13)30-18(16)22-9-11-7-12(21)8-14(17(11)25)24(27)28/h7-9,25H,5-6,10H2,1-4H3 |
| InChIKey | YEIRGVQMBTWKKE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|