C22H28N4O3 — CID 135813581
9-(2-ethoxyphenyl)-2-(3-hydroxypropyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135813581) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 9-(2-ethoxyphenyl)-2-(3-hydroxypropyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(2-ethoxyphenyl)-2-(3-hydroxypropyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135813581 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 9-(2-ethoxyphenyl)-2-(3-hydroxypropyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCOc1ccccc1C1C2=C(CC(C)(C)CC2=O)Nc2nc(CCCO)nn21 |
| InChI | InChI=1S/C22H28N4O3/c1-4-29-17-9-6-5-8-14(17)20-19-15(12-22(2,3)13-16(19)28)23-21-24-18(10-7-11-27)25-26(20)21/h5-6,8-9,20,27H,4,7,10-13H2,1-3H3,(H,23,24,25) |
| InChIKey | JNBNLDPKAFPBLF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |