C19H18N4O2 — CID 135814059
N'-[(E)-1H-indol-3-ylmethylideneamino]-N-[(1R)-1-phenylethyl]oxamide (PubChem CID 135814059) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is N'-[(E)-1H-indol-3-ylmethylideneamino]-N-[(1R)-1-phenylethyl]oxamide.
| Compound Name | N'-[(E)-1H-indol-3-ylmethylideneamino]-N-[(1R)-1-phenylethyl]oxamide |
|---|---|
| PubChem CID | 135814059 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N'-[(E)-1H-indol-3-ylmethylideneamino]-N-[(1R)-1-phenylethyl]oxamide |
| SMILES | C[C@@H](NC(=O)C(=O)N/N=C/c1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C19H18N4O2/c1-13(14-7-3-2-4-8-14)22-18(24)19(25)23-21-12-15-11-20-17-10-6-5-9-16(15)17/h2-13,20H,1H3,(H,22,24)(H,23,25)/b21-12+/t13-/m1/s1 |
| InChIKey | QRMWFFXAXKRNEX-LNOXHEFASA-N |
| XLogP | 2.50 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|