C27H30N4O5 — CID 135814736
2-(3,4-dimethoxyphenyl)-9-(3-ethoxy-4-hydroxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135814736) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-9-(3-ethoxy-4-hydroxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-9-(3-ethoxy-4-hydroxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135814736 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-9-(3-ethoxy-4-hydroxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(-c4ccc(OC)c(OC)c4)nn32)ccc1O |
| InChI | InChI=1S/C27H30N4O5/c1-6-36-21-11-15(7-9-18(21)32)24-23-17(13-27(2,3)14-19(23)33)28-26-29-25(30-31(24)26)16-8-10-20(34-4)22(12-16)35-5/h7-12,24,32H,6,13-14H2,1-5H3,(H,28,29,30) |
| InChIKey | WGINUXDRNDJCQX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |