C18H17N3O3 — CID 135815030
4-[methyl-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]benzoic acid (PubChem CID 135815030) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 4-[methyl-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]benzoic acid.
| Compound Name | 4-[methyl-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 135815030 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-[methyl-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]benzoic acid |
| SMILES | Cc1nc2ccc(CN(C)c3ccc(C(=O)O)cc3)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H17N3O3/c1-11-19-16-8-3-12(9-15(16)17(22)20-11)10-21(2)14-6-4-13(5-7-14)18(23)24/h3-9H,10H2,1-2H3,(H,23,24)(H,19,20,22) |
| InChIKey | FJLUXPHUSAETAK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |