About 2-butylimino-3,5-dihydropurin-6-one
2-butylimino-3,5-dihydropurin-6-one (PubChem CID 135815421) has the molecular formula C9H13N5O
and a molecular weight of 207.24 g/mol. Its IUPAC name is 2-butylimino-3,5-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-butylimino-3,5-dihydropurin-6-one |
| PubChem CID | 135815421 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-butylimino-3,5-dihydropurin-6-one |
| SMILES | CCCC/N=C1\NC(=O)C2N=CN=C2N1 |
| InChI | InChI=1S/C9H13N5O/c1-2-3-4-10-9-13-7-6(8(15)14-9)11-5-12-7/h5-6H,2-4H2,1H3,(H2,10,11,12,13,14,15) |
| InChIKey | QRYCHODGHLXVNZ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-butylimino-3,5-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylimino-3,5-dihydropurin-6-one?
The IUPAC name of 2-butylimino-3,5-dihydropurin-6-one (CID 135815421) is 2-butylimino-3,5-dihydropurin-6-one.
What is the SMILES notation for 2-butylimino-3,5-dihydropurin-6-one?
The canonical SMILES for 2-butylimino-3,5-dihydropurin-6-one is CCCC/N=C1\NC(=O)C2N=CN=C2N1.
What is the InChIKey of 2-butylimino-3,5-dihydropurin-6-one?
The InChIKey is QRYCHODGHLXVNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O/c1-2-3-4-10-9-13-7-6(8(15)14-9)11-5-12-7/h5-6H,2-4H2,1H3,(H2,10,11,12,13,14,15).
What are the key properties of 2-butylimino-3,5-dihydropurin-6-one?
2-butylimino-3,5-dihydropurin-6-one has a molecular weight of 207.24 g/mol, XLogP of -0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylimino-3,5-dihydropurin-6-one is sourced from PubChem (CID 135815421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).