About 8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol
8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol (PubChem CID 135815835) has the molecular formula C22H17N5O
and a molecular weight of 367.41 g/mol. Its IUPAC name is 8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol.
Molecular Properties
| Compound Name | 8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol |
| PubChem CID | 135815835 |
| Molecular Formula | C22H17N5O |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol |
| SMILES | Nc1c(/N=N/c2ccccc2)ccc2ccc(/N=N/c3ccccc3)c(O)c12 |
| InChI | InChI=1S/C22H17N5O/c23-21-18(26-24-16-7-3-1-4-8-16)13-11-15-12-14-19(22(28)20(15)21)27-25-17-9-5-2-6-10-17/h1-14,28H,23H2/b26-24+,27-25+ |
| InChIKey | DJODGHWJSQHHPD-OWUYFMIJSA-N |
| XLogP | 6.96 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol?
The IUPAC name of 8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol (CID 135815835) is 8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol.
What is the SMILES notation for 8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol?
The canonical SMILES for 8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol is Nc1c(/N=N/c2ccccc2)ccc2ccc(/N=N/c3ccccc3)c(O)c12.
What is the InChIKey of 8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol?
The InChIKey is DJODGHWJSQHHPD-OWUYFMIJSA-N. The full InChI is InChI=1S/C22H17N5O/c23-21-18(26-24-16-7-3-1-4-8-16)13-11-15-12-14-19(22(28)20(15)21)27-25-17-9-5-2-6-10-17/h1-14,28H,23H2/b26-24+,27-25+.
What are the key properties of 8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol?
8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol has a molecular weight of 367.41 g/mol, XLogP of 6.96, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-2,7-bis(phenyldiazenyl)naphthalen-1-ol is sourced from PubChem (CID 135815835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).