C22H25N3O4 — CID 135816254
2-(1-adamantyl)-N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]acetamide (PubChem CID 135816254) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]acetamide |
|---|---|
| PubChem CID | 135816254 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-(1-adamantyl)-N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)/N=N/c1c(O)[nH]c2cc3c(cc12)OCCO3 |
| InChI | InChI=1S/C22H25N3O4/c26-19(11-22-8-12-3-13(9-22)5-14(4-12)10-22)24-25-20-15-6-17-18(29-2-1-28-17)7-16(15)23-21(20)27/h6-7,12-14,23,27H,1-5,8-11H2/b25-24+ |
| InChIKey | QCCZLHVSWOJCCV-OCOZRVBESA-N |
| XLogP | 4.86 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|