About 3-(dimethylamino)-4H-1,2,4-triazin-5-one
3-(dimethylamino)-4H-1,2,4-triazin-5-one (PubChem CID 135816279) has the molecular formula C5H8N4O
and a molecular weight of 140.15 g/mol. Its IUPAC name is 3-(dimethylamino)-4H-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 3-(dimethylamino)-4H-1,2,4-triazin-5-one |
| PubChem CID | 135816279 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 3-(dimethylamino)-4H-1,2,4-triazin-5-one |
| SMILES | CN(C)c1nncc(=O)[nH]1 |
| InChI | InChI=1S/C5H8N4O/c1-9(2)5-7-4(10)3-6-8-5/h3H,1-2H3,(H,7,8,10) |
| InChIKey | SCWRRKAMMDBHMS-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(dimethylamino)-4H-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-4H-1,2,4-triazin-5-one?
The IUPAC name of 3-(dimethylamino)-4H-1,2,4-triazin-5-one (CID 135816279) is 3-(dimethylamino)-4H-1,2,4-triazin-5-one.
What is the SMILES notation for 3-(dimethylamino)-4H-1,2,4-triazin-5-one?
The canonical SMILES for 3-(dimethylamino)-4H-1,2,4-triazin-5-one is CN(C)c1nncc(=O)[nH]1.
What is the InChIKey of 3-(dimethylamino)-4H-1,2,4-triazin-5-one?
The InChIKey is SCWRRKAMMDBHMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O/c1-9(2)5-7-4(10)3-6-8-5/h3H,1-2H3,(H,7,8,10).
What are the key properties of 3-(dimethylamino)-4H-1,2,4-triazin-5-one?
3-(dimethylamino)-4H-1,2,4-triazin-5-one has a molecular weight of 140.15 g/mol, XLogP of -0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-4H-1,2,4-triazin-5-one is sourced from PubChem (CID 135816279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).