C23H22ClN3O2 — CID 135816460
6-[(2S)-2-chloro-2-phenylacetyl]-2-[(4-methylphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135816460) has the molecular formula C23H22ClN3O2 and a molecular weight of 407.90 g/mol. Its IUPAC name is 6-[(2S)-2-chloro-2-phenylacetyl]-2-[(4-methylphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(2S)-2-chloro-2-phenylacetyl]-2-[(4-methylphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135816460 |
| Molecular Formula | C23H22ClN3O2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 6-[(2S)-2-chloro-2-phenylacetyl]-2-[(4-methylphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(Cc2nc3c(c(=O)[nH]2)CN(C(=O)[C@@H](Cl)c2ccccc2)CC3)cc1 |
| InChI | InChI=1S/C23H22ClN3O2/c1-15-7-9-16(10-8-15)13-20-25-19-11-12-27(14-18(19)22(28)26-20)23(29)21(24)17-5-3-2-4-6-17/h2-10,21H,11-14H2,1H3,(H,25,26,28)/t21-/m0/s1 |
| InChIKey | GBLKIIHLLINEGD-NRFANRHFSA-N |
| XLogP | 3.53 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|