C11H13N3O6 — CID 135816495
methyl N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]carbamate (PubChem CID 135816495) has the molecular formula C11H13N3O6 and a molecular weight of 283.24 g/mol. Its IUPAC name is methyl N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]carbamate.
| Compound Name | methyl N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 135816495 |
| Molecular Formula | C11H13N3O6 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | methyl N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]carbamate |
| SMILES | CCOc1cc(/C=N\NC(=O)OC)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C11H13N3O6/c1-3-20-9-5-7(6-12-13-11(16)19-2)4-8(10(9)15)14(17)18/h4-6,15H,3H2,1-2H3,(H,13,16)/b12-6- |
| InChIKey | RSDPODYEOYTOHK-SDQBBNPISA-N |
| XLogP | 1.39 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|