C19H28N2O4 — CID 135816579
(2R)-2-[(6,7-dimethoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)amino]-4-methylpentanoic acid (PubChem CID 135816579) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is (2R)-2-[(6,7-dimethoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(6,7-dimethoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 135816579 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (2R)-2-[(6,7-dimethoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)amino]-4-methylpentanoic acid |
| SMILES | COc1cc2c(cc1OC)/C(=N/[C@H](CC(C)C)C(=O)O)NC(C)(C)C2 |
| InChI | InChI=1S/C19H28N2O4/c1-11(2)7-14(18(22)23)20-17-13-9-16(25-6)15(24-5)8-12(13)10-19(3,4)21-17/h8-9,11,14H,7,10H2,1-6H3,(H,20,21)(H,22,23)/t14-/m1/s1 |
| InChIKey | PQBUFHHDBFQNTC-CQSZACIVSA-N |
| XLogP | 2.87 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|