C9H13F2N3 — CID 135816800
(5R,7S)-7-(difluoromethyl)-2,5-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 135816800) has the molecular formula C9H13F2N3 and a molecular weight of 201.22 g/mol. Its IUPAC name is (5R,7S)-7-(difluoromethyl)-2,5-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
| Compound Name | (5R,7S)-7-(difluoromethyl)-2,5-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 135816800 |
| Molecular Formula | C9H13F2N3 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | (5R,7S)-7-(difluoromethyl)-2,5-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc2n(n1)[C@H](C(F)F)C[C@@H](C)N2 |
| InChI | InChI=1S/C9H13F2N3/c1-5-3-7(9(10)11)14-8(12-5)4-6(2)13-14/h4-5,7,9,12H,3H2,1-2H3/t5-,7+/m1/s1 |
| InChIKey | GVCUYVSDJYMDMA-VDTYLAMSSA-N |
| XLogP | 2.20 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |