C11H14N2O2 — CID 135818324
(9E)-9-(hydroxymethylidene)-3,6-dimethyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one (PubChem CID 135818324) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is (9E)-9-(hydroxymethylidene)-3,6-dimethyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | (9E)-9-(hydroxymethylidene)-3,6-dimethyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 135818324 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (9E)-9-(hydroxymethylidene)-3,6-dimethyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cnc2n(c1=O)C(C)CC/C2=C\O |
| InChI | InChI=1S/C11H14N2O2/c1-7-5-12-10-9(6-14)4-3-8(2)13(10)11(7)15/h5-6,8,14H,3-4H2,1-2H3/b9-6+ |
| InChIKey | YMGURNGNSSZJEQ-RMKNXTFCSA-N |
| XLogP | 1.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|