C25H12N4O7 — CID 135818740
3-[(3,5-dinitrophenyl)diazenyl]-4-hydroxy-5-oxapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),3,7,9,11,14,16,18-nonaen-13-one (PubChem CID 135818740) has the molecular formula C25H12N4O7 and a molecular weight of 480.39 g/mol. Its IUPAC name is 3-[(3,5-dinitrophenyl)diazenyl]-4-hydroxy-5-oxapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),3,7,9,11,14,16,18-nonaen-13-one.
| Compound Name | 3-[(3,5-dinitrophenyl)diazenyl]-4-hydroxy-5-oxapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),3,7,9,11,14,16,18-nonaen-13-one |
|---|---|
| PubChem CID | 135818740 |
| Molecular Formula | C25H12N4O7 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 3-[(3,5-dinitrophenyl)diazenyl]-4-hydroxy-5-oxapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),3,7,9,11,14,16,18-nonaen-13-one |
| SMILES | O=C1c2ccccc2-c2c3c1cccc3cc1oc(O)c(/N=N/c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c21 |
| InChI | InChI=1S/C25H12N4O7/c30-24-17-6-2-1-5-16(17)21-20-12(4-3-7-18(20)24)8-19-22(21)23(25(31)36-19)27-26-13-9-14(28(32)33)11-15(10-13)29(34)35/h1-11,31H/b27-26+ |
| InChIKey | VBQZVEZNAWXUAJ-CYYJNZCTSA-N |
| XLogP | 6.73 |
| TPSA | 161.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|