About 2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one
2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one (PubChem CID 135819035) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one |
| PubChem CID | 135819035 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)COC2 |
| InChI | InChI=1S/C7H8N2O2/c1-4-8-6-3-11-2-5(6)7(10)9-4/h2-3H2,1H3,(H,8,9,10) |
| InChIKey | HQBJWFQKIWWGEM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The IUPAC name of 2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one (CID 135819035) is 2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The canonical SMILES for 2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one is Cc1nc2c(c(=O)[nH]1)COC2.
What is the InChIKey of 2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The InChIKey is HQBJWFQKIWWGEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-4-8-6-3-11-2-5(6)7(10)9-4/h2-3H2,1H3,(H,8,9,10).
What are the key properties of 2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one has a molecular weight of 152.15 g/mol, XLogP of 0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 135819035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).