About 2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol
2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol (PubChem CID 135819149) has the molecular formula C22H31NO2
and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol.
Molecular Properties
| Compound Name | 2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol |
| PubChem CID | 135819149 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol |
| SMILES | CCCc1c(C(C)C)nc(C(C)C)c(C(C)O)c1-c1ccccc1O |
| InChI | InChI=1S/C22H31NO2/c1-7-10-17-20(16-11-8-9-12-18(16)25)19(15(6)24)22(14(4)5)23-21(17)13(2)3/h8-9,11-15,24-25H,7,10H2,1-6H3 |
| InChIKey | JSJLLHPAMPKWIX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol?
The IUPAC name of 2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol (CID 135819149) is 2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol.
What is the SMILES notation for 2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol?
The canonical SMILES for 2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol is CCCc1c(C(C)C)nc(C(C)C)c(C(C)O)c1-c1ccccc1O.
What is the InChIKey of 2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol?
The InChIKey is JSJLLHPAMPKWIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO2/c1-7-10-17-20(16-11-8-9-12-18(16)25)19(15(6)24)22(14(4)5)23-21(17)13(2)3/h8-9,11-15,24-25H,7,10H2,1-6H3.
What are the key properties of 2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol?
2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol has a molecular weight of 341.50 g/mol, XLogP of 5.71, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1-hydroxyethyl)-2,6-di(propan-2-yl)-5-propyl-4-pyridinyl]phenol is sourced from PubChem (CID 135819149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).