C15H14N4O2S — CID 135819555
N-(5-methyl-1,3-thiazol-2-yl)-3-(4-oxo-3H-quinazolin-2-yl)propanamide (PubChem CID 135819555) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-3-(4-oxo-3H-quinazolin-2-yl)propanamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-3-(4-oxo-3H-quinazolin-2-yl)propanamide |
|---|---|
| PubChem CID | 135819555 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-3-(4-oxo-3H-quinazolin-2-yl)propanamide |
| SMILES | Cc1cnc(NC(=O)CCc2nc3ccccc3c(=O)[nH]2)s1 |
| InChI | InChI=1S/C15H14N4O2S/c1-9-8-16-15(22-9)19-13(20)7-6-12-17-11-5-3-2-4-10(11)14(21)18-12/h2-5,8H,6-7H2,1H3,(H,16,19,20)(H,17,18,21) |
| InChIKey | CPBUYJWXNFSGGI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |