C25H30N6O — CID 135820360
2-(5-methoxy-1H-indazol-3-yl)-6-(4-piperidin-1-ylpiperidin-1-yl)-1H-benzimidazole (PubChem CID 135820360) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is 2-(5-methoxy-1H-indazol-3-yl)-6-(4-piperidin-1-ylpiperidin-1-yl)-1H-benzimidazole.
| Compound Name | 2-(5-methoxy-1H-indazol-3-yl)-6-(4-piperidin-1-ylpiperidin-1-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 135820360 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 2-(5-methoxy-1H-indazol-3-yl)-6-(4-piperidin-1-ylpiperidin-1-yl)-1H-benzimidazole |
| SMILES | COc1ccc2[nH]nc(-c3nc4ccc(N5CCC(N6CCCCC6)CC5)cc4[nH]3)c2c1 |
| InChI | InChI=1S/C25H30N6O/c1-32-19-6-8-21-20(16-19)24(29-28-21)25-26-22-7-5-18(15-23(22)27-25)31-13-9-17(10-14-31)30-11-3-2-4-12-30/h5-8,15-17H,2-4,9-14H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | LYGHVOBUJSJSHS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |