C15H14NO2S- — CID 135820587
2-[[2-(4-methylphenoxy)acetyl]amino]benzenethiolate (PubChem CID 135820587) has the molecular formula C15H14NO2S- and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[[2-(4-methylphenoxy)acetyl]amino]benzenethiolate.
| Compound Name | 2-[[2-(4-methylphenoxy)acetyl]amino]benzenethiolate |
|---|---|
| PubChem CID | 135820587 |
| Molecular Formula | C15H14NO2S- |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-[[2-(4-methylphenoxy)acetyl]amino]benzenethiolate |
| SMILES | Cc1ccc(OCC(=O)Nc2ccccc2[S-])cc1 |
| InChI | InChI=1S/C15H15NO2S/c1-11-6-8-12(9-7-11)18-10-15(17)16-13-4-2-3-5-14(13)19/h2-9,19H,10H2,1H3,(H,16,17)/p-1 |
| InChIKey | HNZCXASPDYMKLM-UHFFFAOYSA-M |
| XLogP | 2.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|