About N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide
N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide (PubChem CID 135820921) has the molecular formula C21H22FN3O5
and a molecular weight of 415.42 g/mol. Its IUPAC name is N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide.
Molecular Properties
| Compound Name | N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide |
| PubChem CID | 135820921 |
| Molecular Formula | C21H22FN3O5 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide |
| SMILES | CCN(Cc1nc2cc(OC)c(OC)cc2c(=O)[nH]1)C(=O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C21H22FN3O5/c1-4-25(20(26)12-30-14-7-5-13(22)6-8-14)11-19-23-16-10-18(29-3)17(28-2)9-15(16)21(27)24-19/h5-10H,4,11-12H2,1-3H3,(H,23,24,27) |
| InChIKey | DDPOSECDUVKMFO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide?
The IUPAC name of N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide (CID 135820921) is N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide.
What is the SMILES notation for N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide?
The canonical SMILES for N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide is CCN(Cc1nc2cc(OC)c(OC)cc2c(=O)[nH]1)C(=O)COc1ccc(F)cc1.
What is the InChIKey of N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide?
The InChIKey is DDPOSECDUVKMFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN3O5/c1-4-25(20(26)12-30-14-7-5-13(22)6-8-14)11-19-23-16-10-18(29-3)17(28-2)9-15(16)21(27)24-19/h5-10H,4,11-12H2,1-3H3,(H,23,24,27).
What are the key properties of N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide?
N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide has a molecular weight of 415.42 g/mol, XLogP of 2.51, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-2-(4-fluorophenoxy)acetamide is sourced from PubChem (CID 135820921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).