C16H26N4 — CID 135823721
(4aS,8aR)-2-ethylspiro[4a,5,6,7,8,8a-hexahydro-4H-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane] (PubChem CID 135823721) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is (4aS,8aR)-2-ethylspiro[4a,5,6,7,8,8a-hexahydro-4H-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane].
| Compound Name | (4aS,8aR)-2-ethylspiro[4a,5,6,7,8,8a-hexahydro-4H-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane] |
|---|---|
| PubChem CID | 135823721 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | (4aS,8aR)-2-ethylspiro[4a,5,6,7,8,8a-hexahydro-4H-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane] |
| SMILES | CCc1nc2n(n1)C1(CCCCC1)[C@@H]1CCCC[C@@H]1N2 |
| InChI | InChI=1S/C16H26N4/c1-2-14-18-15-17-13-9-5-4-8-12(13)16(20(15)19-14)10-6-3-7-11-16/h12-13H,2-11H2,1H3,(H,17,18,19)/t12-,13+/m1/s1 |
| InChIKey | UTTJAJLPKKAWDI-OLZOCXBDSA-N |
| XLogP | 3.48 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |