C22H23N5O4 — CID 135824978
7-(2,3-dimethoxyphenyl)-2-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135824978) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 7-(2,3-dimethoxyphenyl)-2-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(2,3-dimethoxyphenyl)-2-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135824978 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 7-(2,3-dimethoxyphenyl)-2-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccccc1-c1nc2n(n1)C(c1cccc(OC)c1OC)C(C(N)=O)=C(C)N2 |
| InChI | InChI=1S/C22H23N5O4/c1-12-17(20(23)28)18(14-9-7-11-16(30-3)19(14)31-4)27-22(24-12)25-21(26-27)13-8-5-6-10-15(13)29-2/h5-11,18H,1-4H3,(H2,23,28)(H,24,25,26) |
| InChIKey | DDYVSHMXNMXYGU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |