C29H28BrN5O3 — CID 135825197
7-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135825197) has the molecular formula C29H28BrN5O3 and a molecular weight of 574.48 g/mol. Its IUPAC name is 7-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135825197 |
| Molecular Formula | C29H28BrN5O3 |
| Molecular Weight | 574.48 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | 7-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(C2C(C(=O)Nc3ccc(C)cc3C)=C(C)Nc3ncnn32)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H28BrN5O3/c1-17-10-11-23(18(2)12-17)34-28(36)25-19(3)33-29-31-16-32-35(29)26(25)21-13-22(30)27(24(14-21)37-4)38-15-20-8-6-5-7-9-20/h5-14,16,26H,15H2,1-4H3,(H,34,36)(H,31,32,33) |
| InChIKey | RJGNTLBYWXBJII-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.48 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |