C28H24BrCl2N5O3 — CID 135825300
7-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135825300) has the molecular formula C28H24BrCl2N5O3 and a molecular weight of 629.34 g/mol. Its IUPAC name is 7-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135825300 |
| Molecular Formula | C28H24BrCl2N5O3 |
| Molecular Weight | 629.34 g/mol |
| Exact Mass | 627.04 |
| IUPAC Name | 7-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCOc1cc(C2C(C(=O)Nc3ccccc3)=C(C)Nc3ncnn32)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H24BrCl2N5O3/c1-3-38-23-13-18(12-20(29)26(23)39-14-17-9-10-21(30)22(31)11-17)25-24(16(2)34-28-32-15-33-36(25)28)27(37)35-19-7-5-4-6-8-19/h4-13,15,25H,3,14H2,1-2H3,(H,35,37)(H,32,33,34) |
| InChIKey | OWWIAPCVESLAKG-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.34 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |