C20H27N5O3 — CID 135826931
propan-2-yl 5-methyl-7-(4-pentoxyphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135826931) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is propan-2-yl 5-methyl-7-(4-pentoxyphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl 5-methyl-7-(4-pentoxyphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135826931 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | propan-2-yl 5-methyl-7-(4-pentoxyphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCOc1ccc(C2C(C(=O)OC(C)C)=C(C)Nc3nnnn32)cc1 |
| InChI | InChI=1S/C20H27N5O3/c1-5-6-7-12-27-16-10-8-15(9-11-16)18-17(19(26)28-13(2)3)14(4)21-20-22-23-24-25(18)20/h8-11,13,18H,5-7,12H2,1-4H3,(H,21,22,24) |
| InChIKey | ANKCEEJCOVMMMQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|