C20H24N4O2S — CID 135827817
2-[(2Z,5R)-4-oxo-2-[(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 135827817) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 2-[(2Z,5R)-4-oxo-2-[(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(2Z,5R)-4-oxo-2-[(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 135827817 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-[(2Z,5R)-4-oxo-2-[(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | CC1=CC(N/N=C2/NC(=O)[C@@H](CC(=O)Nc3ccccc3)S2)=CC(C)(C)C1 |
| InChI | InChI=1S/C20H24N4O2S/c1-13-9-15(12-20(2,3)11-13)23-24-19-22-18(26)16(27-19)10-17(25)21-14-7-5-4-6-8-14/h4-9,12,16,23H,10-11H2,1-3H3,(H,21,25)(H,22,24,26)/t16-/m1/s1 |
| InChIKey | AWJWVOGBEHQZAI-MRXNPFEDSA-N |
| XLogP | 3.37 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|