C17H11N2O3S- — CID 135827851
4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]benzoate (PubChem CID 135827851) has the molecular formula C17H11N2O3S- and a molecular weight of 323.35 g/mol. Its IUPAC name is 4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]benzoate.
| Compound Name | 4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]benzoate |
|---|---|
| PubChem CID | 135827851 |
| Molecular Formula | C17H11N2O3S- |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]benzoate |
| SMILES | O=C1N/C(=N\c2ccccc2)S/C1=C\c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H12N2O3S/c20-15-14(10-11-6-8-12(9-7-11)16(21)22)23-17(19-15)18-13-4-2-1-3-5-13/h1-10H,(H,21,22)(H,18,19,20)/p-1/b14-10- |
| InChIKey | MGUIXVWIRPRQGP-UVTDQMKNSA-M |
| XLogP | 1.94 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|