C15H22N2O2 — CID 135828613
5-(hydroxymethyl)-2-methyl-4-[[(1R,2R)-2-methylcyclohexyl]iminomethyl]pyridin-3-ol (PubChem CID 135828613) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-4-[[(1R,2R)-2-methylcyclohexyl]iminomethyl]pyridin-3-ol.
| Compound Name | 5-(hydroxymethyl)-2-methyl-4-[[(1R,2R)-2-methylcyclohexyl]iminomethyl]pyridin-3-ol |
|---|---|
| PubChem CID | 135828613 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-4-[[(1R,2R)-2-methylcyclohexyl]iminomethyl]pyridin-3-ol |
| SMILES | Cc1ncc(CO)c(/C=N/[C@@H]2CCCC[C@H]2C)c1O |
| InChI | InChI=1S/C15H22N2O2/c1-10-5-3-4-6-14(10)17-8-13-12(9-18)7-16-11(2)15(13)19/h7-8,10,14,18-19H,3-6,9H2,1-2H3/b17-8+/t10-,14-/m1/s1 |
| InChIKey | WBQLJQFQLBCBQB-GSAIQRRHSA-N |
| XLogP | 2.59 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|