C23H18N4O3S2 — CID 135829200
(2E)-2-[(3-benzyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]-5-(4-ethoxyphenyl)imino-1,3-oxazole-4-carbonitrile (PubChem CID 135829200) has the molecular formula C23H18N4O3S2 and a molecular weight of 462.56 g/mol. Its IUPAC name is (2E)-2-[(3-benzyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]-5-(4-ethoxyphenyl)imino-1,3-oxazole-4-carbonitrile.
| Compound Name | (2E)-2-[(3-benzyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]-5-(4-ethoxyphenyl)imino-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 135829200 |
| Molecular Formula | C23H18N4O3S2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | (2E)-2-[(3-benzyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]-5-(4-ethoxyphenyl)imino-1,3-oxazole-4-carbonitrile |
| SMILES | CCOc1ccc(/N=C2\O/C(=C/c3sc(=S)n(Cc4ccccc4)c3O)N=C2C#N)cc1 |
| InChI | InChI=1S/C23H18N4O3S2/c1-2-29-17-10-8-16(9-11-17)25-21-18(13-24)26-20(30-21)12-19-22(28)27(23(31)32-19)14-15-6-4-3-5-7-15/h3-12,28H,2,14H2,1H3/b20-12+,25-21- |
| InChIKey | IYNWDMIVWDYCDE-OQBBUMCXSA-N |
| XLogP | 5.46 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|