About 2-methylbenzimidazole-2,4-diol
2-methylbenzimidazole-2,4-diol (PubChem CID 135829567) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 2-methylbenzimidazole-2,4-diol.
Molecular Properties
| Compound Name | 2-methylbenzimidazole-2,4-diol |
| PubChem CID | 135829567 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 2-methylbenzimidazole-2,4-diol |
| SMILES | CC1(O)N=c2cccc(O)c2=N1 |
| InChI | InChI=1S/C8H8N2O2/c1-8(12)9-5-3-2-4-6(11)7(5)10-8/h2-4,11-12H,1H3 |
| InChIKey | MIJQRMMASMRJNR-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylbenzimidazole-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzimidazole-2,4-diol?
The IUPAC name of 2-methylbenzimidazole-2,4-diol (CID 135829567) is 2-methylbenzimidazole-2,4-diol.
What is the SMILES notation for 2-methylbenzimidazole-2,4-diol?
The canonical SMILES for 2-methylbenzimidazole-2,4-diol is CC1(O)N=c2cccc(O)c2=N1.
What is the InChIKey of 2-methylbenzimidazole-2,4-diol?
The InChIKey is MIJQRMMASMRJNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c1-8(12)9-5-3-2-4-6(11)7(5)10-8/h2-4,11-12H,1H3.
What are the key properties of 2-methylbenzimidazole-2,4-diol?
2-methylbenzimidazole-2,4-diol has a molecular weight of 164.16 g/mol, XLogP of -0.69, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzimidazole-2,4-diol is sourced from PubChem (CID 135829567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).