C18H11ClN4O6S — CID 135829837
1-(4-chlorophenyl)-3-[[5-(2-hydroxy-5-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]pyrrolidine-2,5-dione (PubChem CID 135829837) has the molecular formula C18H11ClN4O6S and a molecular weight of 446.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[5-(2-hydroxy-5-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]pyrrolidine-2,5-dione.
| Compound Name | 1-(4-chlorophenyl)-3-[[5-(2-hydroxy-5-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 135829837 |
| Molecular Formula | C18H11ClN4O6S |
| Molecular Weight | 446.83 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[5-(2-hydroxy-5-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Sc2nnc(-c3cc([N+](=O)[O-])ccc3O)o2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H11ClN4O6S/c19-9-1-3-10(4-2-9)22-15(25)8-14(17(22)26)30-18-21-20-16(29-18)12-7-11(23(27)28)5-6-13(12)24/h1-7,14,24H,8H2 |
| InChIKey | QZRZHTCHCFJJKZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|