C15H20Cl3N4O+ — CID 135830107
4-amino-3,5,6-trichloro-N-[(Z)-[(5R)-3,3,5-trimethylcyclohexylidene]amino]pyridin-1-ium-2-carboxamide (PubChem CID 135830107) has the molecular formula C15H20Cl3N4O+ and a molecular weight of 378.71 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(Z)-[(5R)-3,3,5-trimethylcyclohexylidene]amino]pyridin-1-ium-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(Z)-[(5R)-3,3,5-trimethylcyclohexylidene]amino]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135830107 |
| Molecular Formula | C15H20Cl3N4O+ |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(Z)-[(5R)-3,3,5-trimethylcyclohexylidene]amino]pyridin-1-ium-2-carboxamide |
| SMILES | C[C@H]1C/C(=N/NC(=O)c2[nH+]c(Cl)c(Cl)c(N)c2Cl)CC(C)(C)C1 |
| InChI | InChI=1S/C15H19Cl3N4O/c1-7-4-8(6-15(2,3)5-7)21-22-14(23)12-9(16)11(19)10(17)13(18)20-12/h7H,4-6H2,1-3H3,(H2,19,20)(H,22,23)/p+1/b21-8-/t7-/m0/s1 |
| InChIKey | ZSGBVOVWHUFKFI-OYWMVAEXSA-O |
| XLogP | 3.98 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|